C18H26F2NO6S2+ — CID 59422450
4-[4,6-difluoro-2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid (PubChem CID 59422450) has the molecular formula C18H26F2NO6S2+ and a molecular weight of 454.54 g/mol. Its IUPAC name is 4-[4,6-difluoro-2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[4,6-difluoro-2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59422450 |
| Molecular Formula | C18H26F2NO6S2+ |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-[4,6-difluoro-2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CC1=[N+](CCCCS(=O)(=O)O)c2cc(F)cc(F)c2C1(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C18H25F2NO6S2/c1-13-18(2,7-3-5-9-28(22,23)24)17-15(20)11-14(19)12-16(17)21(13)8-4-6-10-29(25,26)27/h11-12H,3-10H2,1-2H3,(H-,22,23,24,25,26,27)/p+1 |
| InChIKey | CSMYHTXIAFCIBI-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|