C22H32F2NO5S+ — CID 143619358
6-[4,7-difluoro-2,3,5,6-tetramethyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid (PubChem CID 143619358) has the molecular formula C22H32F2NO5S+ and a molecular weight of 460.56 g/mol. Its IUPAC name is 6-[4,7-difluoro-2,3,5,6-tetramethyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4,7-difluoro-2,3,5,6-tetramethyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 143619358 |
| Molecular Formula | C22H32F2NO5S+ |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 6-[4,7-difluoro-2,3,5,6-tetramethyl-3-(4-sulfobutyl)indol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2c(F)c(C)c(C)c(F)c2C1(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C22H31F2NO5S/c1-14-15(2)20(24)21-18(19(14)23)22(4,11-7-9-13-31(28,29)30)16(3)25(21)12-8-5-6-10-17(26)27/h5-13H2,1-4H3,(H-,26,27,28,29,30)/p+1 |
| InChIKey | ZTTGSTQEJCDFBQ-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|