C22H27F6NO5S — CID 16718310
4-[3-(5-carboxypentyl)-2,3-dimethyl-4,6-bis(trifluoromethyl)indol-1-ium-1-yl]butane-1-sulfonate (PubChem CID 16718310) has the molecular formula C22H27F6NO5S and a molecular weight of 531.52 g/mol. Its IUPAC name is 4-[3-(5-carboxypentyl)-2,3-dimethyl-4,6-bis(trifluoromethyl)indol-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[3-(5-carboxypentyl)-2,3-dimethyl-4,6-bis(trifluoromethyl)indol-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 16718310 |
| Molecular Formula | C22H27F6NO5S |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 4-[3-(5-carboxypentyl)-2,3-dimethyl-4,6-bis(trifluoromethyl)indol-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CC1=[N+](CCCCS(=O)(=O)[O-])c2cc(C(F)(F)F)cc(C(F)(F)F)c2C1(C)CCCCCC(=O)O |
| InChI | InChI=1S/C22H27F6NO5S/c1-14-20(2,9-5-3-4-8-18(30)31)19-16(22(26,27)28)12-15(21(23,24)25)13-17(19)29(14)10-6-7-11-35(32,33)34/h12-13H,3-11H2,1-2H3,(H-,30,31,32,33,34) |
| InChIKey | VEOCHGGTTQOPQI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|