C19H25F3NO6S3- — CID 87185957
4-[2,3-dimethyl-1-(4-sulfonatobutyl)-5-(trifluoromethylsulfanyl)indol-1-ium-3-yl]butane-1-sulfonate (PubChem CID 87185957) has the molecular formula C19H25F3NO6S3- and a molecular weight of 516.61 g/mol. Its IUPAC name is 4-[2,3-dimethyl-1-(4-sulfonatobutyl)-5-(trifluoromethylsulfanyl)indol-1-ium-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2,3-dimethyl-1-(4-sulfonatobutyl)-5-(trifluoromethylsulfanyl)indol-1-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 87185957 |
| Molecular Formula | C19H25F3NO6S3- |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 4-[2,3-dimethyl-1-(4-sulfonatobutyl)-5-(trifluoromethylsulfanyl)indol-1-ium-3-yl]butane-1-sulfonate |
| SMILES | CC1=[N+](CCCCS(=O)(=O)[O-])c2ccc(SC(F)(F)F)cc2C1(C)CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H26F3NO6S3/c1-14-18(2,9-3-5-11-31(24,25)26)16-13-15(30-19(20,21)22)7-8-17(16)23(14)10-4-6-12-32(27,28)29/h7-8,13H,3-6,9-12H2,1-2H3,(H-,24,25,26,27,28,29)/p-1 |
| InChIKey | RWCXPUIJYWCQFI-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 117.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|