C14H18NNaO6S2 — CID 158490347
sodium;sulfur trioxide;3-(2,3,3-trimethyl-5H-indol-1-ium-5-id-1-yl)propane-1-sulfonate (PubChem CID 158490347) has the molecular formula C14H18NNaO6S2 and a molecular weight of 383.42 g/mol. Its IUPAC name is sodium;sulfur trioxide;3-(2,3,3-trimethyl-5H-indol-1-ium-5-id-1-yl)propane-1-sulfonate.
| Compound Name | sodium;sulfur trioxide;3-(2,3,3-trimethyl-5H-indol-1-ium-5-id-1-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 158490347 |
| Molecular Formula | C14H18NNaO6S2 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | sodium;sulfur trioxide;3-(2,3,3-trimethyl-5H-indol-1-ium-5-id-1-yl)propane-1-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)[O-])c2cc[c-]cc2C1(C)C.O=S(=O)=O.[Na+] |
| InChI | InChI=1S/C14H19NO3S.Na.O3S/c1-11-14(2,3)12-7-4-5-8-13(12)15(11)9-6-10-19(16,17)18;;1-4(2)3/h5,7-8H,6,9-10H2,1-3H3,(H,16,17,18);;/q;+1;/p-1 |
| InChIKey | KGLYBQICQXMDNC-UHFFFAOYSA-M |
| XLogP | -2.18 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|