C15H22NO3S+ — CID 91303876
3-(2,3,3,5-tetramethylindol-1-ium-1-yl)propane-1-sulfonic acid (PubChem CID 91303876) has the molecular formula C15H22NO3S+ and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(2,3,3,5-tetramethylindol-1-ium-1-yl)propane-1-sulfonic acid.
| Compound Name | 3-(2,3,3,5-tetramethylindol-1-ium-1-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91303876 |
| Molecular Formula | C15H22NO3S+ |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(2,3,3,5-tetramethylindol-1-ium-1-yl)propane-1-sulfonic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc(C)cc2C1(C)C |
| InChI | InChI=1S/C15H21NO3S/c1-11-6-7-14-13(10-11)15(3,4)12(2)16(14)8-5-9-20(17,18)19/h6-7,10H,5,8-9H2,1-4H3/p+1 |
| InChIKey | URLBFWCQHFUPSQ-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|