C17H28Br2N2O3S — CID 166048355
trimethyl-[3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propyl]azanium dibromide (PubChem CID 166048355) has the molecular formula C17H28Br2N2O3S and a molecular weight of 500.30 g/mol. Its IUPAC name is trimethyl-[3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propyl]azanium dibromide.
| Compound Name | trimethyl-[3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propyl]azanium dibromide |
|---|---|
| PubChem CID | 166048355 |
| Molecular Formula | C17H28Br2N2O3S |
| Molecular Weight | 500.30 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | trimethyl-[3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propyl]azanium dibromide |
| SMILES | CC1=[N+](CCC[N+](C)(C)C)c2ccc(S(=O)(=O)O)cc2C1(C)C.[Br-].[Br-] |
| InChI | InChI=1S/C17H27N2O3S.2BrH/c1-13-17(2,3)15-12-14(23(20,21)22)8-9-16(15)18(13)10-7-11-19(4,5)6;;/h8-9,12H,7,10-11H2,1-6H3;2*1H/q+1;;/p-1 |
| InChIKey | QVLXITJJQLNXSQ-UHFFFAOYSA-M |
| XLogP | -3.57 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.30 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|