C15H19KNO3S — CID 172786191
CID 172786191 (PubChem CID 172786191) has the molecular formula C15H19KNO3S and a molecular weight of 332.49 g/mol.
| Compound Name | CID 172786191 |
|---|---|
| PubChem CID | 172786191 |
| Molecular Formula | C15H19KNO3S |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | — |
| SMILES | C=CCC[N+]1=C(C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21.[K] |
| InChI | InChI=1S/C15H19NO3S.K/c1-5-6-9-16-11(2)15(3,4)13-10-12(20(17,18)19)7-8-14(13)16;/h5,7-8,10H,1,6,9H2,2-4H3; |
| InChIKey | OXSBOIFWTCSXAY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|