C31H49N3O8S — CID 59855442
1-[6-[[7-carboxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]heptyl]amino]-6-oxohexyl]-2,3,3-trimethylindol-1-ium-5-sulfonate (PubChem CID 59855442) has the molecular formula C31H49N3O8S and a molecular weight of 623.81 g/mol. Its IUPAC name is 1-[6-[[7-carboxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]heptyl]amino]-6-oxohexyl]-2,3,3-trimethylindol-1-ium-5-sulfonate.
| Compound Name | 1-[6-[[7-carboxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]heptyl]amino]-6-oxohexyl]-2,3,3-trimethylindol-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 59855442 |
| Molecular Formula | C31H49N3O8S |
| Molecular Weight | 623.81 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | 1-[6-[[7-carboxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]heptyl]amino]-6-oxohexyl]-2,3,3-trimethylindol-1-ium-5-sulfonate |
| SMILES | CC1=[N+](CCCCCC(=O)NCC(CCCCCC(=O)O)CNC(=O)OC(C)(C)C)c2ccc(S(=O)(=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C31H49N3O8S/c1-22-31(5,6)25-19-24(43(39,40)41)16-17-26(25)34(22)18-12-8-10-14-27(35)32-20-23(13-9-7-11-15-28(36)37)21-33-29(38)42-30(2,3)4/h16-17,19,23H,7-15,18,20-21H2,1-6H3,(H3-,32,33,35,36,37,38,39,40,41) |
| InChIKey | GEXMJYYCZQCUAI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|