C37H44ClN2O10S2- — CID 4520054
1-(5-carboxypentyl)-2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl]-2-chloropenta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonate (PubChem CID 4520054) has the molecular formula C37H44ClN2O10S2- and a molecular weight of 776.35 g/mol. Its IUPAC name is 1-(5-carboxypentyl)-2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl]-2-chloropenta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonate.
| Compound Name | 1-(5-carboxypentyl)-2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl]-2-chloropenta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 4520054 |
| Molecular Formula | C37H44ClN2O10S2- |
| Molecular Weight | 776.35 g/mol |
| Exact Mass | 775.21 |
| IUPAC Name | 1-(5-carboxypentyl)-2-[5-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfonatoindol-1-ium-2-yl]-2-chloropenta-2,4-dienylidene]-3,3-dimethylindole-5-sulfonate |
| SMILES | CC1(C)C(=CC(Cl)=CC=CC2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)N(CCCCCC(=O)O)c2ccc(S(=O)(=O)[O-])cc21 |
| InChI | InChI=1S/C37H45ClN2O10S2/c1-36(2)28-23-26(51(45,46)47)16-18-30(28)39(20-9-5-7-14-34(41)42)32(36)13-11-12-25(38)22-33-37(3,4)29-24-27(52(48,49)50)17-19-31(29)40(33)21-10-6-8-15-35(43)44/h11-13,16-19,22-24H,5-10,14-15,20-21H2,1-4H3,(H3-,41,42,43,44,45,46,47,48,49,50)/p-1 |
| InChIKey | IIQSJSPQMBNVGE-UHFFFAOYSA-M |
| XLogP | 6.52 |
| TPSA | 195.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|