C34H45N2O9S2+ — CID 123149162
6-[2-[(E,3E)-3-[1-(2-methoxyethyl)-5-methoxysulfonyl-3,3-dimethylindol-2-ylidene]prop-1-enyl]-5-methoxysulfonyl-3,3-dimethylindol-1-ium-1-yl]hexanoic acid (PubChem CID 123149162) has the molecular formula C34H45N2O9S2+ and a molecular weight of 689.87 g/mol. Its IUPAC name is 6-[2-[(E,3E)-3-[1-(2-methoxyethyl)-5-methoxysulfonyl-3,3-dimethylindol-2-ylidene]prop-1-enyl]-5-methoxysulfonyl-3,3-dimethylindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(E,3E)-3-[1-(2-methoxyethyl)-5-methoxysulfonyl-3,3-dimethylindol-2-ylidene]prop-1-enyl]-5-methoxysulfonyl-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 123149162 |
| Molecular Formula | C34H45N2O9S2+ |
| Molecular Weight | 689.87 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | 6-[2-[(E,3E)-3-[1-(2-methoxyethyl)-5-methoxysulfonyl-3,3-dimethylindol-2-ylidene]prop-1-enyl]-5-methoxysulfonyl-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
| SMILES | COCCN1/C(=C/C=C/C2=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)OC)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)OC)ccc21 |
| InChI | InChI=1S/C34H44N2O9S2/c1-33(2)26-22-24(46(39,40)44-6)15-17-28(26)35(19-10-8-9-14-32(37)38)30(33)12-11-13-31-34(3,4)27-23-25(47(41,42)45-7)16-18-29(27)36(31)20-21-43-5/h11-13,15-18,22-23H,8-10,14,19-21H2,1-7H3/p+1 |
| InChIKey | ORXPFTWDYYVEAL-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.87 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|