C35H47N2O10P2+ — CID 73226074
6-[2-[3-[1-(5-carboxypentyl)-3,3-dimethyl-5-phosphonoindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid (PubChem CID 73226074) has the molecular formula C35H47N2O10P2+ and a molecular weight of 717.71 g/mol. Its IUPAC name is 6-[2-[3-[1-(5-carboxypentyl)-3,3-dimethyl-5-phosphonoindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[3-[1-(5-carboxypentyl)-3,3-dimethyl-5-phosphonoindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 73226074 |
| Molecular Formula | C35H47N2O10P2+ |
| Molecular Weight | 717.71 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | 6-[2-[3-[1-(5-carboxypentyl)-3,3-dimethyl-5-phosphonoindol-1-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCCCC(=O)O)c3ccc(P(=O)(O)O)cc3C2(C)C)N(CCCCCC(=O)O)c2ccc(P(=O)(O)O)cc21 |
| InChI | InChI=1S/C35H46N2O10P2/c1-34(2)26-22-24(48(42,43)44)16-18-28(26)36(20-9-5-7-14-32(38)39)30(34)12-11-13-31-35(3,4)27-23-25(49(45,46)47)17-19-29(27)37(31)21-10-6-8-15-33(40)41/h11-13,16-19,22-23H,5-10,14-15,20-21H2,1-4H3,(H5-,38,39,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | XIBMFKFYRUICBW-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 195.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|