C34H44N2O8PS+ — CID 101449545
6-[2-[(3E)-4-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]buta-1,3-dienylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid (PubChem CID 101449545) has the molecular formula C34H44N2O8PS+ and a molecular weight of 671.77 g/mol. Its IUPAC name is 6-[2-[(3E)-4-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]buta-1,3-dienylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(3E)-4-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]buta-1,3-dienylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 101449545 |
| Molecular Formula | C34H44N2O8PS+ |
| Molecular Weight | 671.77 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | 6-[2-[(3E)-4-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]buta-1,3-dienylidene]-3,3-dimethyl-5-phosphonoindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(=C=C/C=C/C2=[N+](CCCCS(=O)(=O)O)c3ccccc3C2(C)C)N(CCCCCC(=O)O)c2ccc(P(=O)(O)O)cc21 |
| InChI | InChI=1S/C34H43N2O8PS/c1-33(2)26-14-7-8-15-28(26)35(22-12-13-23-46(42,43)44)30(33)16-9-10-17-31-34(3,4)27-24-25(45(39,40)41)19-20-29(27)36(31)21-11-5-6-18-32(37)38/h7-10,14-16,19-20,24H,5-6,11-13,18,21-23H2,1-4H3,(H3-,37,38,39,40,41,42,43,44)/p+1/b16-9+ |
| InChIKey | SGXHZUQXMHYKMM-CXUHLZMHSA-O |
| XLogP | 5.57 |
| TPSA | 155.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.77 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|