C35H43N3O7P+ — CID 54761559
[(2E)-2-[(E)-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindol-5-yl]phosphonic acid (PubChem CID 54761559) has the molecular formula C35H43N3O7P+ and a molecular weight of 648.72 g/mol. Its IUPAC name is [(2E)-2-[(E)-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindol-5-yl]phosphonic acid.
| Compound Name | [(2E)-2-[(E)-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindol-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 54761559 |
| Molecular Formula | C35H43N3O7P+ |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | [(2E)-2-[(E)-3-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3-dimethylindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindol-5-yl]phosphonic acid |
| SMILES | CCN1/C(=C/C=C/C2=[N+](CCCCCC(=O)ON3C(=O)CCC3=O)c3ccccc3C2(C)C)C(C)(C)c2cc(P(=O)(O)O)ccc21 |
| InChI | InChI=1S/C35H42N3O7P/c1-6-36-28-19-18-24(46(42,43)44)23-26(28)35(4,5)29(36)15-12-16-30-34(2,3)25-13-9-10-14-27(25)37(30)22-11-7-8-17-33(41)45-38-31(39)20-21-32(38)40/h9-10,12-16,18-19,23H,6-8,11,17,20-22H2,1-5H3,(H-,42,43,44)/p+1 |
| InChIKey | QOGNYJWCFXPJKF-UHFFFAOYSA-O |
| XLogP | 5.29 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|