C17H24NO2+ — CID 58174617
5-(2,3,3,5-tetramethylindol-1-ium-1-yl)pentanoic acid (PubChem CID 58174617) has the molecular formula C17H24NO2+ and a molecular weight of 274.38 g/mol. Its IUPAC name is 5-(2,3,3,5-tetramethylindol-1-ium-1-yl)pentanoic acid.
| Compound Name | 5-(2,3,3,5-tetramethylindol-1-ium-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 58174617 |
| Molecular Formula | C17H24NO2+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 5-(2,3,3,5-tetramethylindol-1-ium-1-yl)pentanoic acid |
| SMILES | CC1=[N+](CCCCC(=O)O)c2ccc(C)cc2C1(C)C |
| InChI | InChI=1S/C17H23NO2/c1-12-8-9-15-14(11-12)17(3,4)13(2)18(15)10-6-5-7-16(19)20/h8-9,11H,5-7,10H2,1-4H3/p+1 |
| InChIKey | KERIXWAVKSWUQB-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|