C18H29BrNO+ — CID 159882637
methane;6-(2,3,3-trimethylindol-1-ium-1-yl)hexan-2-one;hydrobromide (PubChem CID 159882637) has the molecular formula C18H29BrNO+ and a molecular weight of 355.34 g/mol. Its IUPAC name is methane;6-(2,3,3-trimethylindol-1-ium-1-yl)hexan-2-one;hydrobromide.
| Compound Name | methane;6-(2,3,3-trimethylindol-1-ium-1-yl)hexan-2-one;hydrobromide |
|---|---|
| PubChem CID | 159882637 |
| Molecular Formula | C18H29BrNO+ |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | methane;6-(2,3,3-trimethylindol-1-ium-1-yl)hexan-2-one;hydrobromide |
| SMILES | Br.C.CC(=O)CCCC[N+]1=C(C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C17H24NO.CH4.BrH/c1-13(19)9-7-8-12-18-14(2)17(3,4)15-10-5-6-11-16(15)18;;/h5-6,10-11H,7-9,12H2,1-4H3;1H4;1H/q+1;; |
| InChIKey | LSXLNEUPTGGKLS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|