C18H26BrNO2 — CID 12039338
ethyl 5-(2,3,3-trimethylindol-1-ium-1-yl)pentanoate bromide (PubChem CID 12039338) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is ethyl 5-(2,3,3-trimethylindol-1-ium-1-yl)pentanoate bromide.
| Compound Name | ethyl 5-(2,3,3-trimethylindol-1-ium-1-yl)pentanoate bromide |
|---|---|
| PubChem CID | 12039338 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl 5-(2,3,3-trimethylindol-1-ium-1-yl)pentanoate bromide |
| SMILES | CCOC(=O)CCCC[N+]1=C(C)C(C)(C)c2ccccc21.[Br-] |
| InChI | InChI=1S/C18H26NO2.BrH/c1-5-21-17(20)12-8-9-13-19-14(2)18(3,4)15-10-6-7-11-16(15)19;/h6-7,10-11H,5,8-9,12-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | LKDWLRJDUPRLBU-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|