C14H21BrN2 — CID 10424688
3-(2,3,3-trimethylindol-1-ium-1-yl)propan-1-amine bromide (PubChem CID 10424688) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 3-(2,3,3-trimethylindol-1-ium-1-yl)propan-1-amine bromide.
| Compound Name | 3-(2,3,3-trimethylindol-1-ium-1-yl)propan-1-amine bromide |
|---|---|
| PubChem CID | 10424688 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-(2,3,3-trimethylindol-1-ium-1-yl)propan-1-amine bromide |
| SMILES | CC1=[N+](CCCN)c2ccccc2C1(C)C.[Br-] |
| InChI | InChI=1S/C14H21N2.BrH/c1-11-14(2,3)12-7-4-5-8-13(12)16(11)10-6-9-15;/h4-5,7-8H,6,9-10,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZVOSCKGTKZKDOW-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|