C17H23BrNNaO5S — CID 163296952
sodium;1-(5-carboxypentyl)-2,3,3-trimethylindol-1-ium-5-sulfonate;bromide (PubChem CID 163296952) has the molecular formula C17H23BrNNaO5S and a molecular weight of 456.33 g/mol. Its IUPAC name is sodium;1-(5-carboxypentyl)-2,3,3-trimethylindol-1-ium-5-sulfonate;bromide.
| Compound Name | sodium;1-(5-carboxypentyl)-2,3,3-trimethylindol-1-ium-5-sulfonate;bromide |
|---|---|
| PubChem CID | 163296952 |
| Molecular Formula | C17H23BrNNaO5S |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | sodium;1-(5-carboxypentyl)-2,3,3-trimethylindol-1-ium-5-sulfonate;bromide |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)[O-])cc2C1(C)C.[Br-].[Na+] |
| InChI | InChI=1S/C17H23NO5S.BrH.Na/c1-12-17(2,3)14-11-13(24(21,22)23)8-9-15(14)18(12)10-6-4-5-7-16(19)20;;/h8-9,11H,4-7,10H2,1-3H3,(H-,19,20,21,22,23);1H;/q;;+1/p-1 |
| InChIKey | UMMMUDZCHFSZQF-UHFFFAOYSA-M |
| XLogP | -3.36 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|