C16H23NNaO5S+ — CID 173002736
sodium;hydride;5-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)pentanoic acid (PubChem CID 173002736) has the molecular formula C16H23NNaO5S+ and a molecular weight of 364.42 g/mol. Its IUPAC name is sodium;hydride;5-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)pentanoic acid.
| Compound Name | sodium;hydride;5-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 173002736 |
| Molecular Formula | C16H23NNaO5S+ |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | sodium;hydride;5-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)pentanoic acid |
| SMILES | CC1=[N+](CCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C.[H-].[Na+] |
| InChI | InChI=1S/C16H21NO5S.Na.H/c1-11-16(2,3)13-10-12(23(20,21)22)7-8-14(13)17(11)9-5-4-6-15(18)19;;/h7-8,10H,4-6,9H2,1-3H3,(H-,18,19,20,21,22);;/q;+1;-1/p+1 |
| InChIKey | FWCQVLSDWXXBHJ-UHFFFAOYSA-O |
| XLogP | -0.30 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|