C20H24NO5S+ — CID 86635535
5-(1,1,2-trimethyl-7-sulfobenzo[e]indol-3-ium-3-yl)pentanoic acid (PubChem CID 86635535) has the molecular formula C20H24NO5S+ and a molecular weight of 390.48 g/mol. Its IUPAC name is 5-(1,1,2-trimethyl-7-sulfobenzo[e]indol-3-ium-3-yl)pentanoic acid.
| Compound Name | 5-(1,1,2-trimethyl-7-sulfobenzo[e]indol-3-ium-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 86635535 |
| Molecular Formula | C20H24NO5S+ |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-(1,1,2-trimethyl-7-sulfobenzo[e]indol-3-ium-3-yl)pentanoic acid |
| SMILES | CC1=[N+](CCCCC(=O)O)c2ccc3cc(S(=O)(=O)O)ccc3c2C1(C)C |
| InChI | InChI=1S/C20H23NO5S/c1-13-20(2,3)19-16-9-8-15(27(24,25)26)12-14(16)7-10-17(19)21(13)11-5-4-6-18(22)23/h7-10,12H,4-6,11H2,1-3H3,(H-,22,23,24,25,26)/p+1 |
| InChIKey | ZMKOPPAWZXMWSC-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|