C19H24NOS+ — CID 90927708
1,1,2-trimethyl-3-(4-sulfanylbutyl)benzo[e]indol-3-ium-7-ol (PubChem CID 90927708) has the molecular formula C19H24NOS+ and a molecular weight of 314.47 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(4-sulfanylbutyl)benzo[e]indol-3-ium-7-ol.
| Compound Name | 1,1,2-trimethyl-3-(4-sulfanylbutyl)benzo[e]indol-3-ium-7-ol |
|---|---|
| PubChem CID | 90927708 |
| Molecular Formula | C19H24NOS+ |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1,1,2-trimethyl-3-(4-sulfanylbutyl)benzo[e]indol-3-ium-7-ol |
| SMILES | CC1=[N+](CCCCS)c2ccc3cc(O)ccc3c2C1(C)C |
| InChI | InChI=1S/C19H23NOS/c1-13-19(2,3)18-16-8-7-15(21)12-14(16)6-9-17(18)20(13)10-4-5-11-22/h6-9,12H,4-5,10-11H2,1-3H3,(H-,21,22)/p+1 |
| InChIKey | SGMWAYSSNVEVJH-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|