C15H22NO6S2+ — CID 56614138
2,3,3-trimethyl-1-(4-sulfobutyl)indol-1-ium-4-sulfonic acid (PubChem CID 56614138) has the molecular formula C15H22NO6S2+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 2,3,3-trimethyl-1-(4-sulfobutyl)indol-1-ium-4-sulfonic acid.
| Compound Name | 2,3,3-trimethyl-1-(4-sulfobutyl)indol-1-ium-4-sulfonic acid |
|---|---|
| PubChem CID | 56614138 |
| Molecular Formula | C15H22NO6S2+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2,3,3-trimethyl-1-(4-sulfobutyl)indol-1-ium-4-sulfonic acid |
| SMILES | CC1=[N+](CCCCS(=O)(=O)O)c2cccc(S(=O)(=O)O)c2C1(C)C |
| InChI | InChI=1S/C15H21NO6S2/c1-11-15(2,3)14-12(7-6-8-13(14)24(20,21)22)16(11)9-4-5-10-23(17,18)19/h6-8H,4-5,9-10H2,1-3H3,(H-,17,18,19,20,21,22)/p+1 |
| InChIKey | JVQKUTCXDBCTPP-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|