C15H22NO3S+ — CID 152768984
3-(1,2,3,3-tetramethylindol-1-ium-4-yl)propane-1-sulfonic acid (PubChem CID 152768984) has the molecular formula C15H22NO3S+ and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(1,2,3,3-tetramethylindol-1-ium-4-yl)propane-1-sulfonic acid.
| Compound Name | 3-(1,2,3,3-tetramethylindol-1-ium-4-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 152768984 |
| Molecular Formula | C15H22NO3S+ |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(1,2,3,3-tetramethylindol-1-ium-4-yl)propane-1-sulfonic acid |
| SMILES | CC1=[N+](C)c2cccc(CCCS(=O)(=O)O)c2C1(C)C |
| InChI | InChI=1S/C15H21NO3S/c1-11-15(2,3)14-12(8-6-10-20(17,18)19)7-5-9-13(14)16(11)4/h5,7,9H,6,8,10H2,1-4H3/p+1 |
| InChIKey | UFZNERVJXPWIQS-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|