C12H20N2O6S2 — CID 18324633
3-[3,6-diamino-2-(3-sulfopropyl)phenyl]propane-1-sulfonic acid (PubChem CID 18324633) has the molecular formula C12H20N2O6S2 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[3,6-diamino-2-(3-sulfopropyl)phenyl]propane-1-sulfonic acid.
| Compound Name | 3-[3,6-diamino-2-(3-sulfopropyl)phenyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 18324633 |
| Molecular Formula | C12H20N2O6S2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-[3,6-diamino-2-(3-sulfopropyl)phenyl]propane-1-sulfonic acid |
| SMILES | Nc1ccc(N)c(CCCS(=O)(=O)O)c1CCCS(=O)(=O)O |
| InChI | InChI=1S/C12H20N2O6S2/c13-11-5-6-12(14)10(4-2-8-22(18,19)20)9(11)3-1-7-21(15,16)17/h5-6H,1-4,7-8,13-14H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | ASITUUHZTALBTG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|