C20H28N2O6S2 — CID 101366071
4-[2-amino-5-[4-amino-3-(4-sulfobutyl)phenyl]phenyl]butane-1-sulfonic acid (PubChem CID 101366071) has the molecular formula C20H28N2O6S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[2-amino-5-[4-amino-3-(4-sulfobutyl)phenyl]phenyl]butane-1-sulfonic acid.
| Compound Name | 4-[2-amino-5-[4-amino-3-(4-sulfobutyl)phenyl]phenyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 101366071 |
| Molecular Formula | C20H28N2O6S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-[2-amino-5-[4-amino-3-(4-sulfobutyl)phenyl]phenyl]butane-1-sulfonic acid |
| SMILES | Nc1ccc(-c2ccc(N)c(CCCCS(=O)(=O)O)c2)cc1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C20H28N2O6S2/c21-19-9-7-15(13-17(19)5-1-3-11-29(23,24)25)16-8-10-20(22)18(14-16)6-2-4-12-30(26,27)28/h7-10,13-14H,1-6,11-12,21-22H2,(H,23,24,25)(H,26,27,28) |
| InChIKey | IQTVPSJXWJSIEI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|