C9H11NO6S — CID 166506499
3-(2-hydroxy-4-nitrophenyl)propane-1-sulfonic acid (PubChem CID 166506499) has the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. Its IUPAC name is 3-(2-hydroxy-4-nitrophenyl)propane-1-sulfonic acid.
| Compound Name | 3-(2-hydroxy-4-nitrophenyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166506499 |
| Molecular Formula | C9H11NO6S |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 3-(2-hydroxy-4-nitrophenyl)propane-1-sulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(CCCS(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C9H11NO6S/c11-9-6-8(10(12)13)4-3-7(9)2-1-5-17(14,15)16/h3-4,6,11H,1-2,5H2,(H,14,15,16) |
| InChIKey | JMWHMNSCYPJLLE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|