C13H10N2O7S — CID 23207592
4-[(2,4-dinitrophenyl)methyl]benzenesulfonic acid (PubChem CID 23207592) has the molecular formula C13H10N2O7S and a molecular weight of 338.30 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)methyl]benzenesulfonic acid.
| Compound Name | 4-[(2,4-dinitrophenyl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 23207592 |
| Molecular Formula | C13H10N2O7S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)methyl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(Cc2ccc(S(=O)(=O)O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N2O7S/c16-14(17)11-4-3-10(13(8-11)15(18)19)7-9-1-5-12(6-2-9)23(20,21)22/h1-6,8H,7H2,(H,20,21,22) |
| InChIKey | MBDUYGCPAYBMKT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|