C23H18N2O8 — CID 58156902
3-[3-[4-[(2,4-dinitrophenyl)methyl]phenoxy]-2-oxopropyl]benzoic acid (PubChem CID 58156902) has the molecular formula C23H18N2O8 and a molecular weight of 450.40 g/mol. Its IUPAC name is 3-[3-[4-[(2,4-dinitrophenyl)methyl]phenoxy]-2-oxopropyl]benzoic acid.
| Compound Name | 3-[3-[4-[(2,4-dinitrophenyl)methyl]phenoxy]-2-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 58156902 |
| Molecular Formula | C23H18N2O8 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[3-[4-[(2,4-dinitrophenyl)methyl]phenoxy]-2-oxopropyl]benzoic acid |
| SMILES | O=C(COc1ccc(Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H18N2O8/c26-20(12-16-2-1-3-18(11-16)23(27)28)14-33-21-8-4-15(5-9-21)10-17-6-7-19(24(29)30)13-22(17)25(31)32/h1-9,11,13H,10,12,14H2,(H,27,28) |
| InChIKey | GLXMFWHZWZJQBG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|