C10H13NO8S2 — CID 87256026
2-[4-nitro-2-(2-sulfoethyl)phenyl]ethanesulfonic acid (PubChem CID 87256026) has the molecular formula C10H13NO8S2 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[4-nitro-2-(2-sulfoethyl)phenyl]ethanesulfonic acid.
| Compound Name | 2-[4-nitro-2-(2-sulfoethyl)phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87256026 |
| Molecular Formula | C10H13NO8S2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[4-nitro-2-(2-sulfoethyl)phenyl]ethanesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(CCS(=O)(=O)O)c(CCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H13NO8S2/c12-11(13)10-2-1-8(3-5-20(14,15)16)9(7-10)4-6-21(17,18)19/h1-2,7H,3-6H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | JDPCIOJZOQSWBV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|