C18H28NO6S2+ — CID 59422446
4-[2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid (PubChem CID 59422446) has the molecular formula C18H28NO6S2+ and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-[2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59422446 |
| Molecular Formula | C18H28NO6S2+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-[2,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CC1=[N+](CCCCS(=O)(=O)O)c2ccccc2C1(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C18H27NO6S2/c1-15-18(2,11-5-7-13-26(20,21)22)16-9-3-4-10-17(16)19(15)12-6-8-14-27(23,24)25/h3-4,9-10H,5-8,11-14H2,1-2H3,(H-,20,21,22,23,24,25)/p+1 |
| InChIKey | QBAAOANUCKZHHZ-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|