C21H26NO3S+ — CID 89271891
4-(2,3,3-trimethyl-5-phenylindol-1-ium-1-yl)butane-1-sulfonic acid (PubChem CID 89271891) has the molecular formula C21H26NO3S+ and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-(2,3,3-trimethyl-5-phenylindol-1-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | 4-(2,3,3-trimethyl-5-phenylindol-1-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 89271891 |
| Molecular Formula | C21H26NO3S+ |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-(2,3,3-trimethyl-5-phenylindol-1-ium-1-yl)butane-1-sulfonic acid |
| SMILES | CC1=[N+](CCCCS(=O)(=O)O)c2ccc(-c3ccccc3)cc2C1(C)C |
| InChI | InChI=1S/C21H25NO3S/c1-16-21(2,3)19-15-18(17-9-5-4-6-10-17)11-12-20(19)22(16)13-7-8-14-26(23,24)25/h4-6,9-12,15H,7-8,13-14H2,1-3H3/p+1 |
| InChIKey | INIVJFPSJHAECB-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|