C19H22NO5S+ — CID 171764971
1,1,2-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-carboxylic acid (PubChem CID 171764971) has the molecular formula C19H22NO5S+ and a molecular weight of 376.45 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-carboxylic acid.
| Compound Name | 1,1,2-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-carboxylic acid |
|---|---|
| PubChem CID | 171764971 |
| Molecular Formula | C19H22NO5S+ |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1,1,2-trimethyl-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-carboxylic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc3ccc(C(=O)O)cc3c2C1(C)C |
| InChI | InChI=1S/C19H21NO5S/c1-12-19(2,3)17-15-11-14(18(21)22)6-5-13(15)7-8-16(17)20(12)9-4-10-26(23,24)25/h5-8,11H,4,9-10H2,1-3H3,(H-,21,22,23,24,25)/p+1 |
| InChIKey | UFVLVGSWUSKJTH-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|