C22H32NO13S3+ — CID 123566048
2-[4-(1-carboxy-3-sulfopropyl)-2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-6-yl]-4-sulfobutanoic acid (PubChem CID 123566048) has the molecular formula C22H32NO13S3+ and a molecular weight of 614.69 g/mol. Its IUPAC name is 2-[4-(1-carboxy-3-sulfopropyl)-2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-6-yl]-4-sulfobutanoic acid.
| Compound Name | 2-[4-(1-carboxy-3-sulfopropyl)-2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-6-yl]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 123566048 |
| Molecular Formula | C22H32NO13S3+ |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.10 |
| IUPAC Name | 2-[4-(1-carboxy-3-sulfopropyl)-2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-6-yl]-4-sulfobutanoic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2cc(C(CCS(=O)(=O)O)C(=O)O)cc(C(CCS(=O)(=O)O)C(=O)O)c2C1(C)C |
| InChI | InChI=1S/C22H31NO13S3/c1-13-22(2,3)19-17(16(21(26)27)6-10-39(34,35)36)11-14(15(20(24)25)5-9-38(31,32)33)12-18(19)23(13)7-4-8-37(28,29)30/h11-12,15-16H,4-10H2,1-3H3,(H4-,24,25,26,27,28,29,30,31,32,33,34,35,36)/p+1 |
| InChIKey | USGUQZDXRLQVAA-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 240.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|