C14H19NO9S3 — CID 172998554
2,3,3-trimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-7-sulfonate (PubChem CID 172998554) has the molecular formula C14H19NO9S3 and a molecular weight of 441.51 g/mol. Its IUPAC name is 2,3,3-trimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-7-sulfonate.
| Compound Name | 2,3,3-trimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-7-sulfonate |
|---|---|
| PubChem CID | 172998554 |
| Molecular Formula | C14H19NO9S3 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2,3,3-trimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-7-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2c(cc(S(=O)(=O)O)cc2S(=O)(=O)[O-])C1(C)C |
| InChI | InChI=1S/C14H19NO9S3/c1-9-14(2,3)11-7-10(26(19,20)21)8-12(27(22,23)24)13(11)15(9)5-4-6-25(16,17)18/h7-8H,4-6H2,1-3H3,(H2-,16,17,18,19,20,21,22,23,24) |
| InChIKey | SYSMOZKHODJHMW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 168.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|