C19H30NO7S2+ — CID 87761646
3-(6-hydroxyhexyl)-2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 87761646) has the molecular formula C19H30NO7S2+ and a molecular weight of 448.58 g/mol. Its IUPAC name is 3-(6-hydroxyhexyl)-2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 3-(6-hydroxyhexyl)-2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 87761646 |
| Molecular Formula | C19H30NO7S2+ |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-(6-hydroxyhexyl)-2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)CCCCCCO |
| InChI | InChI=1S/C19H29NO7S2/c1-15-19(2,10-5-3-4-6-12-21)17-14-16(29(25,26)27)8-9-18(17)20(15)11-7-13-28(22,23)24/h8-9,14,21H,3-7,10-13H2,1-2H3,(H-,22,23,24,25,26,27)/p+1 |
| InChIKey | RXPPHKSFAHGGQZ-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|