C17H26NO7S2+ — CID 123390640
3-[1-(2-methoxyethyl)-5-methoxysulfonyl-2,3-dimethylindol-1-ium-3-yl]propane-1-sulfonic acid (PubChem CID 123390640) has the molecular formula C17H26NO7S2+ and a molecular weight of 420.53 g/mol. Its IUPAC name is 3-[1-(2-methoxyethyl)-5-methoxysulfonyl-2,3-dimethylindol-1-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[1-(2-methoxyethyl)-5-methoxysulfonyl-2,3-dimethylindol-1-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123390640 |
| Molecular Formula | C17H26NO7S2+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[1-(2-methoxyethyl)-5-methoxysulfonyl-2,3-dimethylindol-1-ium-3-yl]propane-1-sulfonic acid |
| SMILES | COCC[N+]1=C(C)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)OC)ccc21 |
| InChI | InChI=1S/C17H25NO7S2/c1-13-17(2,8-5-11-26(19,20)21)15-12-14(27(22,23)25-4)6-7-16(15)18(13)9-10-24-3/h6-7,12H,5,8-11H2,1-4H3/p+1 |
| InChIKey | OCCWRPCZOOESRB-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|