C25H34NO2+ — CID 53259066
10-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)decanoic acid (PubChem CID 53259066) has the molecular formula C25H34NO2+ and a molecular weight of 380.55 g/mol. Its IUPAC name is 10-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)decanoic acid.
| Compound Name | 10-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)decanoic acid |
|---|---|
| PubChem CID | 53259066 |
| Molecular Formula | C25H34NO2+ |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 10-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)decanoic acid |
| SMILES | CC1=[N+](CCCCCCCCCC(=O)O)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C25H33NO2/c1-19-25(2,3)24-21-14-11-10-13-20(21)16-17-22(24)26(19)18-12-8-6-4-5-7-9-15-23(27)28/h10-11,13-14,16-17H,4-9,12,15,18H2,1-3H3/p+1 |
| InChIKey | JIQBCKLXALJAKD-UHFFFAOYSA-O |
| XLogP | 6.44 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|