C21H26BrNO2 — CID 53259232
methyl 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentanoate bromide (PubChem CID 53259232) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is methyl 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentanoate bromide.
| Compound Name | methyl 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentanoate bromide |
|---|---|
| PubChem CID | 53259232 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | methyl 5-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)pentanoate bromide |
| SMILES | COC(=O)CCCC[N+]1=C(C)C(C)(C)c2c1ccc1ccccc21.[Br-] |
| InChI | InChI=1S/C21H26NO2.BrH/c1-15-21(2,3)20-17-10-6-5-9-16(17)12-13-18(20)22(15)14-8-7-11-19(23)24-4;/h5-6,9-10,12-13H,7-8,11,14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IRROMNTVINFTIU-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|