C26H25BrN2O2 — CID 23283808
2-[3-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)propyl]isoindole-1,3-dione bromide (PubChem CID 23283808) has the molecular formula C26H25BrN2O2 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-[3-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)propyl]isoindole-1,3-dione bromide.
| Compound Name | 2-[3-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)propyl]isoindole-1,3-dione bromide |
|---|---|
| PubChem CID | 23283808 |
| Molecular Formula | C26H25BrN2O2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[3-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)propyl]isoindole-1,3-dione bromide |
| SMILES | CC1=[N+](CCCN2C(=O)c3ccccc3C2=O)c2ccc3ccccc3c2C1(C)C.[Br-] |
| InChI | InChI=1S/C26H25N2O2.BrH/c1-17-26(2,3)23-19-10-5-4-9-18(19)13-14-22(23)27(17)15-8-16-28-24(29)20-11-6-7-12-21(20)25(28)30;/h4-7,9-14H,8,15-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LRLTZVUKJQCPJX-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|