C23H30NNa2O7S2+ — CID 140576373
disodium;4-[1,1,2-trimethyl-8-(4-sulfonatobutoxy)benzo[e]indol-3-ium-3-yl]butane-1-sulfonate (PubChem CID 140576373) has the molecular formula C23H30NNa2O7S2+ and a molecular weight of 542.61 g/mol. Its IUPAC name is disodium;4-[1,1,2-trimethyl-8-(4-sulfonatobutoxy)benzo[e]indol-3-ium-3-yl]butane-1-sulfonate.
| Compound Name | disodium;4-[1,1,2-trimethyl-8-(4-sulfonatobutoxy)benzo[e]indol-3-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 140576373 |
| Molecular Formula | C23H30NNa2O7S2+ |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | disodium;4-[1,1,2-trimethyl-8-(4-sulfonatobutoxy)benzo[e]indol-3-ium-3-yl]butane-1-sulfonate |
| SMILES | CC1=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccc(OCCCCS(=O)(=O)[O-])cc3c2C1(C)C.[Na+].[Na+] |
| InChI | InChI=1S/C23H31NO7S2.2Na/c1-17-23(2,3)22-20-16-19(31-13-5-7-15-33(28,29)30)10-8-18(20)9-11-21(22)24(17)12-4-6-14-32(25,26)27;;/h8-11,16H,4-7,12-15H2,1-3H3,(H-,25,26,27,28,29,30);;/q;2*+1/p-1 |
| InChIKey | VFBLJVDMDBNSCR-UHFFFAOYSA-M |
| XLogP | -2.73 |
| TPSA | 126.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|