C38H46N2O6S2 — CID 159396247
oxathiane 2,2-dioxide;1,1,2-trimethylbenzo[e]indole;4-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)butane-1-sulfonate (PubChem CID 159396247) has the molecular formula C38H46N2O6S2 and a molecular weight of 690.93 g/mol. Its IUPAC name is oxathiane 2,2-dioxide;1,1,2-trimethylbenzo[e]indole;4-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)butane-1-sulfonate.
| Compound Name | oxathiane 2,2-dioxide;1,1,2-trimethylbenzo[e]indole;4-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 159396247 |
| Molecular Formula | C38H46N2O6S2 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | oxathiane 2,2-dioxide;1,1,2-trimethylbenzo[e]indole;4-(1,1,2-trimethylbenzo[e]indol-3-ium-3-yl)butane-1-sulfonate |
| SMILES | CC1=Nc2ccc3ccccc3c2C1(C)C.CC1=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c2C1(C)C.O=S1(=O)CCCCO1 |
| InChI | InChI=1S/C19H23NO3S.C15H15N.C4H8O3S/c1-14-19(2,3)18-16-9-5-4-8-15(16)10-11-17(18)20(14)12-6-7-13-24(21,22)23;1-10-15(2,3)14-12-7-5-4-6-11(12)8-9-13(14)16-10;5-8(6)4-2-1-3-7-8/h4-5,8-11H,6-7,12-13H2,1-3H3;4-9H,1-3H3;1-4H2 |
| InChIKey | LMTFYOKLYKFWGS-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|