C25H35BrNO3S+ — CID 53260911
3-(10-bromodecyl)-1,1,2-trimethylbenzo[e]indol-3-ium-6-sulfonic acid (PubChem CID 53260911) has the molecular formula C25H35BrNO3S+ and a molecular weight of 509.53 g/mol. Its IUPAC name is 3-(10-bromodecyl)-1,1,2-trimethylbenzo[e]indol-3-ium-6-sulfonic acid.
| Compound Name | 3-(10-bromodecyl)-1,1,2-trimethylbenzo[e]indol-3-ium-6-sulfonic acid |
|---|---|
| PubChem CID | 53260911 |
| Molecular Formula | C25H35BrNO3S+ |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 3-(10-bromodecyl)-1,1,2-trimethylbenzo[e]indol-3-ium-6-sulfonic acid |
| SMILES | CC1=[N+](CCCCCCCCCCBr)c2ccc3c(S(=O)(=O)O)cccc3c2C1(C)C |
| InChI | InChI=1S/C25H34BrNO3S/c1-19-25(2,3)24-21-13-12-14-23(31(28,29)30)20(21)15-16-22(24)27(19)18-11-9-7-5-4-6-8-10-17-26/h12-16H,4-11,17-18H2,1-3H3/p+1 |
| InChIKey | UMKIKHVXYOAXQX-UHFFFAOYSA-O |
| XLogP | 7.00 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|