C41H47Br3N2O6S2 — CID 161030981
3-(1-bromopentyl)-2-[3-[3-(5-bromopentyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indole-6-sulfonic acid;sulfur trioxide;bromide (PubChem CID 161030981) has the molecular formula C41H47Br3N2O6S2 and a molecular weight of 967.68 g/mol. Its IUPAC name is 3-(1-bromopentyl)-2-[3-[3-(5-bromopentyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indole-6-sulfonic acid;sulfur trioxide;bromide.
| Compound Name | 3-(1-bromopentyl)-2-[3-[3-(5-bromopentyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indole-6-sulfonic acid;sulfur trioxide;bromide |
|---|---|
| PubChem CID | 161030981 |
| Molecular Formula | C41H47Br3N2O6S2 |
| Molecular Weight | 967.68 g/mol |
| Exact Mass | 964.04 |
| IUPAC Name | 3-(1-bromopentyl)-2-[3-[3-(5-bromopentyl)-1,1-dimethylbenzo[e]indol-3-ium-2-yl]prop-2-enylidene]-1,1-dimethylbenzo[e]indole-6-sulfonic acid;sulfur trioxide;bromide |
| SMILES | CCCCC(Br)N1C(=CC=CC2=[N+](CCCCCBr)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1c(S(=O)(=O)O)cccc21.O=S(=O)=O.[Br-] |
| InChI | InChI=1S/C41H46Br2N2O3S.BrH.O3S/c1-6-7-21-37(43)45-33-25-23-30-31(17-13-18-34(30)49(46,47)48)39(33)41(4,5)36(45)20-14-19-35-40(2,3)38-29-16-10-9-15-28(29)22-24-32(38)44(35)27-12-8-11-26-42;;1-4(2)3/h9-10,13-20,22-25,37H,6-8,11-12,21,26-27H2,1-5H3;1H; |
| InChIKey | FLUQYVCJFLUKKS-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|