C23H30N2O7S2 — CID 153438414
3-[6-[3-carboxypropyl(methyl)sulfamoyl]-1,1,2-trimethylbenzo[e]indol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 153438414) has the molecular formula C23H30N2O7S2 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-[6-[3-carboxypropyl(methyl)sulfamoyl]-1,1,2-trimethylbenzo[e]indol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[6-[3-carboxypropyl(methyl)sulfamoyl]-1,1,2-trimethylbenzo[e]indol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 153438414 |
| Molecular Formula | C23H30N2O7S2 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 3-[6-[3-carboxypropyl(methyl)sulfamoyl]-1,1,2-trimethylbenzo[e]indol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)[O-])c2ccc3c(S(=O)(=O)N(C)CCCC(=O)O)cccc3c2C1(C)C |
| InChI | InChI=1S/C23H30N2O7S2/c1-16-23(2,3)22-18-8-5-9-20(34(31,32)24(4)13-6-10-21(26)27)17(18)11-12-19(22)25(16)14-7-15-33(28,29)30/h5,8-9,11-12H,6-7,10,13-15H2,1-4H3,(H-,26,27,28,29,30) |
| InChIKey | UDDVRGQRJRMGSC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|