C29H40N3O7S+ — CID 86589125
2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-5-sulfonate;carboxymethyl(trimethyl)azanium (PubChem CID 86589125) has the molecular formula C29H40N3O7S+ and a molecular weight of 574.72 g/mol. Its IUPAC name is 2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-5-sulfonate;carboxymethyl(trimethyl)azanium.
| Compound Name | 2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-5-sulfonate;carboxymethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 86589125 |
| Molecular Formula | C29H40N3O7S+ |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-5-sulfonate;carboxymethyl(trimethyl)azanium |
| SMILES | CC1(C)C(/C=C/Nc2ccccc2)=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)[O-])cc21.C[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C24H28N2O5S.C5H11NO2/c1-24(2)20-17-19(32(29,30)31)12-13-21(20)26(16-8-4-7-11-23(27)28)22(24)14-15-25-18-9-5-3-6-10-18;1-6(2,3)4-5(7)8/h3,5-6,9-10,12-15,17H,4,7-8,11,16H2,1-2H3,(H2,27,28,29,30,31);4H2,1-3H3/p+1 |
| InChIKey | UHUZSFJZMXCCAP-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|