C28H33N2NaO5S — CID 58341931
sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5H-indol-1-ium-5-id-1-yl]propane-1-sulfonate (PubChem CID 58341931) has the molecular formula C28H33N2NaO5S and a molecular weight of 532.64 g/mol. Its IUPAC name is sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5H-indol-1-ium-5-id-1-yl]propane-1-sulfonate.
| Compound Name | sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5H-indol-1-ium-5-id-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 58341931 |
| Molecular Formula | C28H33N2NaO5S |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3-(5-carboxypentyl)-3-methyl-5H-indol-1-ium-5-id-1-yl]propane-1-sulfonate |
| SMILES | CC1(CCCCCC(=O)O)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)[O-])c2cc[c-]cc21.[Na+] |
| InChI | InChI=1S/C28H33N2O5S.Na/c1-28(19-10-3-6-18-27(31)32)24-15-7-8-16-25(24)30(21-12-22-36(33,34)35)26(28)17-9-11-20-29-23-13-4-2-5-14-23;/h2,4-5,8-9,11,13-17,20H,3,6,10,12,18-19,21-22H2,1H3,(H2,31,32,33,34,35);/q-1;+1 |
| InChIKey | WCPDHWRNOZQSBS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|