C27H28N2O9S3 — CID 159139541
3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1,1-dimethyl-8-sulfobenzo[e]indol-3-ium-3-yl]propane-1-sulfonate;sulfur trioxide (PubChem CID 159139541) has the molecular formula C27H28N2O9S3 and a molecular weight of 620.73 g/mol. Its IUPAC name is 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1,1-dimethyl-8-sulfobenzo[e]indol-3-ium-3-yl]propane-1-sulfonate;sulfur trioxide.
| Compound Name | 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1,1-dimethyl-8-sulfobenzo[e]indol-3-ium-3-yl]propane-1-sulfonate;sulfur trioxide |
|---|---|
| PubChem CID | 159139541 |
| Molecular Formula | C27H28N2O9S3 |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1,1-dimethyl-8-sulfobenzo[e]indol-3-ium-3-yl]propane-1-sulfonate;sulfur trioxide |
| SMILES | CC1(C)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)[O-])c2ccc3ccc(S(=O)(=O)O)cc3c21.O=S(=O)=O |
| InChI | InChI=1S/C27H28N2O6S2.O3S/c1-27(2)25(11-6-7-16-28-21-9-4-3-5-10-21)29(17-8-18-36(30,31)32)24-15-13-20-12-14-22(37(33,34)35)19-23(20)26(24)27;1-4(2)3/h3-7,9-16,19H,8,17-18H2,1-2H3,(H2,30,31,32,33,34,35); |
| InChIKey | FSLDLHVNEQLAFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 177.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|