C25H27N2O9S3+ — CID 171764966
2-[(E)-2-anilinoethenyl]-1-methyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-sulfonic acid (PubChem CID 171764966) has the molecular formula C25H27N2O9S3+ and a molecular weight of 595.70 g/mol. Its IUPAC name is 2-[(E)-2-anilinoethenyl]-1-methyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-sulfonic acid.
| Compound Name | 2-[(E)-2-anilinoethenyl]-1-methyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-sulfonic acid |
|---|---|
| PubChem CID | 171764966 |
| Molecular Formula | C25H27N2O9S3+ |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | 2-[(E)-2-anilinoethenyl]-1-methyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-8-sulfonic acid |
| SMILES | CC1(CS(=O)(=O)O)C(/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc3ccc(S(=O)(=O)O)cc3c21 |
| InChI | InChI=1S/C25H26N2O9S3/c1-25(17-38(31,32)33)23(12-13-26-19-6-3-2-4-7-19)27(14-5-15-37(28,29)30)22-11-9-18-8-10-20(39(34,35)36)16-21(18)24(22)25/h2-4,6-13,16H,5,14-15,17H2,1H3,(H3,28,29,30,31,32,33,34,35,36)/p+1 |
| InChIKey | UFPSYSMGGMKBNG-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 178.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|