C32H35N2O5S+ — CID 89016821
6-[(3R)-2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1-benzyl-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid (PubChem CID 89016821) has the molecular formula C32H35N2O5S+ and a molecular weight of 559.71 g/mol. Its IUPAC name is 6-[(3R)-2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1-benzyl-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid.
| Compound Name | 6-[(3R)-2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1-benzyl-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 89016821 |
| Molecular Formula | C32H35N2O5S+ |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 6-[(3R)-2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-1-benzyl-3-methyl-5-(trioxidanylsulfanyl)indol-1-ium-3-yl]hexanoic acid |
| SMILES | C[C@]1(CCCCCC(=O)O)C(/C=C/C=C/Nc2ccccc2)=[N+](Cc2ccccc2)c2ccc(SOOO)cc21 |
| InChI | InChI=1S/C32H34N2O5S/c1-32(21-11-4-9-18-31(35)36)28-23-27(40-39-38-37)19-20-29(28)34(24-25-13-5-2-6-14-25)30(32)17-10-12-22-33-26-15-7-3-8-16-26/h2-3,5-8,10,12-17,19-20,22-23H,4,9,11,18,21,24H2,1H3,(H2,35,36,37)/p+1/t32-/m1/s1 |
| InChIKey | YMLIWEDPNDBBBP-JGCGQSQUSA-O |
| XLogP | 7.89 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|